C18H17FIN3O3S — CID 68918422
2-(2-fluoro-4-iodoanilino)-N,N-bis(2-hydroxyethyl)thieno[2,3-b]pyridine-3-carboxamide (PubChem CID 68918422) has the molecular formula C18H17FIN3O3S and a molecular weight of 501.32 g/mol. Its IUPAC name is 2-(2-fluoro-4-iodoanilino)-N,N-bis(2-hydroxyethyl)thieno[2,3-b]pyridine-3-carboxamide.
| Compound Name | 2-(2-fluoro-4-iodoanilino)-N,N-bis(2-hydroxyethyl)thieno[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 68918422 |
| Molecular Formula | C18H17FIN3O3S |
| Molecular Weight | 501.32 g/mol |
| Exact Mass | 501.00 |
| IUPAC Name | 2-(2-fluoro-4-iodoanilino)-N,N-bis(2-hydroxyethyl)thieno[2,3-b]pyridine-3-carboxamide |
| SMILES | O=C(c1c(Nc2ccc(I)cc2F)sc2ncccc12)N(CCO)CCO |
| InChI | InChI=1S/C18H17FIN3O3S/c19-13-10-11(20)3-4-14(13)22-17-15(12-2-1-5-21-16(12)27-17)18(26)23(6-8-24)7-9-25/h1-5,10,22,24-25H,6-9H2 |
| InChIKey | SRDWFRKRSMXTDL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|