C23H24FIN4O3S — CID 68917503
tert-butyl N-[(3R)-1-[2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridine-3-carbonyl]pyrrolidin-3-yl]carbamate (PubChem CID 68917503) has the molecular formula C23H24FIN4O3S and a molecular weight of 582.44 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridine-3-carbonyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridine-3-carbonyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 68917503 |
| Molecular Formula | C23H24FIN4O3S |
| Molecular Weight | 582.44 g/mol |
| Exact Mass | 582.06 |
| IUPAC Name | tert-butyl N-[(3R)-1-[2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridine-3-carbonyl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN(C(=O)c2c(Nc3ccc(I)cc3F)sc3ncccc23)C1 |
| InChI | InChI=1S/C23H24FIN4O3S/c1-23(2,3)32-22(31)27-14-8-10-29(12-14)21(30)18-15-5-4-9-26-19(15)33-20(18)28-17-7-6-13(25)11-16(17)24/h4-7,9,11,14,28H,8,10,12H2,1-3H3,(H,27,31)/t14-/m1/s1 |
| InChIKey | PRWNMBSRRZNPAM-CQSZACIVSA-N |
| XLogP | 5.52 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|