C18H16FIN2O2S — CID 135382524
4-tert-butyl-2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridine-3-carboxylic acid (PubChem CID 135382524) has the molecular formula C18H16FIN2O2S and a molecular weight of 470.31 g/mol. Its IUPAC name is 4-tert-butyl-2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridine-3-carboxylic acid.
| Compound Name | 4-tert-butyl-2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 135382524 |
| Molecular Formula | C18H16FIN2O2S |
| Molecular Weight | 470.31 g/mol |
| Exact Mass | 470.00 |
| IUPAC Name | 4-tert-butyl-2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridine-3-carboxylic acid |
| SMILES | CC(C)(C)c1ccnc2sc(Nc3ccc(I)cc3F)c(C(=O)O)c12 |
| InChI | InChI=1S/C18H16FIN2O2S/c1-18(2,3)10-6-7-21-15-13(10)14(17(23)24)16(25-15)22-12-5-4-9(20)8-11(12)19/h4-8,22H,1-3H3,(H,23,24) |
| InChIKey | VSTVMSJFMUEQHE-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.31 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|