C19H18FIN2O3S — CID 135382834
tert-butyl 2-(2-fluoro-4-iodoanilino)-6-methoxythieno[2,3-b]pyridine-3-carboxylate (PubChem CID 135382834) has the molecular formula C19H18FIN2O3S and a molecular weight of 500.33 g/mol. Its IUPAC name is tert-butyl 2-(2-fluoro-4-iodoanilino)-6-methoxythieno[2,3-b]pyridine-3-carboxylate.
| Compound Name | tert-butyl 2-(2-fluoro-4-iodoanilino)-6-methoxythieno[2,3-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 135382834 |
| Molecular Formula | C19H18FIN2O3S |
| Molecular Weight | 500.33 g/mol |
| Exact Mass | 500.01 |
| IUPAC Name | tert-butyl 2-(2-fluoro-4-iodoanilino)-6-methoxythieno[2,3-b]pyridine-3-carboxylate |
| SMILES | COc1ccc2c(C(=O)OC(C)(C)C)c(Nc3ccc(I)cc3F)sc2n1 |
| InChI | InChI=1S/C19H18FIN2O3S/c1-19(2,3)26-18(24)15-11-6-8-14(25-4)23-16(11)27-17(15)22-13-7-5-10(21)9-12(13)20/h5-9,22H,1-4H3 |
| InChIKey | NFVWLJNVWXKBCM-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.33 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|