C21H22FIN4O4S — CID 67083644
tert-butyl 5-(cyclopropylsulfonylamino)-4-(2-fluoro-4-iodoanilino)indazole-1-carboxylate (PubChem CID 67083644) has the molecular formula C21H22FIN4O4S and a molecular weight of 572.40 g/mol. Its IUPAC name is tert-butyl 5-(cyclopropylsulfonylamino)-4-(2-fluoro-4-iodoanilino)indazole-1-carboxylate.
| Compound Name | tert-butyl 5-(cyclopropylsulfonylamino)-4-(2-fluoro-4-iodoanilino)indazole-1-carboxylate |
|---|---|
| PubChem CID | 67083644 |
| Molecular Formula | C21H22FIN4O4S |
| Molecular Weight | 572.40 g/mol |
| Exact Mass | 572.04 |
| IUPAC Name | tert-butyl 5-(cyclopropylsulfonylamino)-4-(2-fluoro-4-iodoanilino)indazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ncc2c(Nc3ccc(I)cc3F)c(NS(=O)(=O)C3CC3)ccc21 |
| InChI | InChI=1S/C21H22FIN4O4S/c1-21(2,3)31-20(28)27-18-9-8-17(26-32(29,30)13-5-6-13)19(14(18)11-24-27)25-16-7-4-12(23)10-15(16)22/h4,7-11,13,25-26H,5-6H2,1-3H3 |
| InChIKey | UWRIJKKZNCLMMP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.40 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|