C23H18F4IN3O3S — CID 156808795
5-[[3-(cyclopropylsulfonylamino)-2-fluorophenyl]methyl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide (PubChem CID 156808795) has the molecular formula C23H18F4IN3O3S and a molecular weight of 619.38 g/mol. Its IUPAC name is 5-[[3-(cyclopropylsulfonylamino)-2-fluorophenyl]methyl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide.
| Compound Name | 5-[[3-(cyclopropylsulfonylamino)-2-fluorophenyl]methyl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 156808795 |
| Molecular Formula | C23H18F4IN3O3S |
| Molecular Weight | 619.38 g/mol |
| Exact Mass | 619.00 |
| IUPAC Name | 5-[[3-(cyclopropylsulfonylamino)-2-fluorophenyl]methyl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
| SMILES | NC(=O)c1cc(Cc2cccc(NS(=O)(=O)C3CC3)c2F)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C23H18F4IN3O3S/c24-16-10-13(28)4-7-17(16)30-22-15(23(29)32)9-12(20(26)21(22)27)8-11-2-1-3-18(19(11)25)31-35(33,34)14-5-6-14/h1-4,7,9-10,14,30-31H,5-6,8H2,(H2,29,32) |
| InChIKey | AFPAJDOKDKWGGI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.38 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|