C21H18F3IN4O3S — CID 156808738
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[[3-(methylsulfamoylamino)phenyl]methyl]benzamide (PubChem CID 156808738) has the molecular formula C21H18F3IN4O3S and a molecular weight of 590.37 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[[3-(methylsulfamoylamino)phenyl]methyl]benzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[[3-(methylsulfamoylamino)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 156808738 |
| Molecular Formula | C21H18F3IN4O3S |
| Molecular Weight | 590.37 g/mol |
| Exact Mass | 590.01 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[[3-(methylsulfamoylamino)phenyl]methyl]benzamide |
| SMILES | CNS(=O)(=O)Nc1cccc(Cc2cc(C(N)=O)c(Nc3ccc(I)cc3F)c(F)c2F)c1 |
| InChI | InChI=1S/C21H18F3IN4O3S/c1-27-33(31,32)29-14-4-2-3-11(8-14)7-12-9-15(21(26)30)20(19(24)18(12)23)28-17-6-5-13(25)10-16(17)22/h2-6,8-10,27-29H,7H2,1H3,(H2,26,30) |
| InChIKey | BOUKILWEXWLSRJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|