C22H18F4IN3O4S — CID 156808803
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[[2-fluoro-3-(methanesulfonamido)phenyl]methyl]-N-methoxybenzamide (PubChem CID 156808803) has the molecular formula C22H18F4IN3O4S and a molecular weight of 623.37 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[[2-fluoro-3-(methanesulfonamido)phenyl]methyl]-N-methoxybenzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[[2-fluoro-3-(methanesulfonamido)phenyl]methyl]-N-methoxybenzamide |
|---|---|
| PubChem CID | 156808803 |
| Molecular Formula | C22H18F4IN3O4S |
| Molecular Weight | 623.37 g/mol |
| Exact Mass | 623.00 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[[2-fluoro-3-(methanesulfonamido)phenyl]methyl]-N-methoxybenzamide |
| SMILES | CONC(=O)c1cc(Cc2cccc(NS(C)(=O)=O)c2F)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C22H18F4IN3O4S/c1-34-29-22(31)14-9-12(8-11-4-3-5-17(18(11)24)30-35(2,32)33)19(25)20(26)21(14)28-16-7-6-13(27)10-15(16)23/h3-7,9-10,28,30H,8H2,1-2H3,(H,29,31) |
| InChIKey | OZMFPIJIZRXMPR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|