C26H26ClF3IN3O4S — CID 156808883
2-(2-chloro-4-iodoanilino)-5-[[3-(ethylsulfonylamino)-2-fluorophenyl]methyl]-3,4-difluoro-N-[(2-methylpropan-2-yl)oxy]benzamide (PubChem CID 156808883) has the molecular formula C26H26ClF3IN3O4S and a molecular weight of 695.93 g/mol. Its IUPAC name is 2-(2-chloro-4-iodoanilino)-5-[[3-(ethylsulfonylamino)-2-fluorophenyl]methyl]-3,4-difluoro-N-[(2-methylpropan-2-yl)oxy]benzamide.
| Compound Name | 2-(2-chloro-4-iodoanilino)-5-[[3-(ethylsulfonylamino)-2-fluorophenyl]methyl]-3,4-difluoro-N-[(2-methylpropan-2-yl)oxy]benzamide |
|---|---|
| PubChem CID | 156808883 |
| Molecular Formula | C26H26ClF3IN3O4S |
| Molecular Weight | 695.93 g/mol |
| Exact Mass | 695.03 |
| IUPAC Name | 2-(2-chloro-4-iodoanilino)-5-[[3-(ethylsulfonylamino)-2-fluorophenyl]methyl]-3,4-difluoro-N-[(2-methylpropan-2-yl)oxy]benzamide |
| SMILES | CCS(=O)(=O)Nc1cccc(Cc2cc(C(=O)NOC(C)(C)C)c(Nc3ccc(I)cc3Cl)c(F)c2F)c1F |
| InChI | InChI=1S/C26H26ClF3IN3O4S/c1-5-39(36,37)34-20-8-6-7-14(21(20)28)11-15-12-17(25(35)33-38-26(2,3)4)24(23(30)22(15)29)32-19-10-9-16(31)13-18(19)27/h6-10,12-13,32,34H,5,11H2,1-4H3,(H,33,35) |
| InChIKey | MEPYJUWXGSNWDU-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.93 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|