C26H25F4IN4O4S — CID 156808854
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[[2-fluoro-3-[(1-methylcyclobutyl)sulfamoylamino]phenyl]methyl]-N-methoxybenzamide (PubChem CID 156808854) has the molecular formula C26H25F4IN4O4S and a molecular weight of 692.47 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[[2-fluoro-3-[(1-methylcyclobutyl)sulfamoylamino]phenyl]methyl]-N-methoxybenzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[[2-fluoro-3-[(1-methylcyclobutyl)sulfamoylamino]phenyl]methyl]-N-methoxybenzamide |
|---|---|
| PubChem CID | 156808854 |
| Molecular Formula | C26H25F4IN4O4S |
| Molecular Weight | 692.47 g/mol |
| Exact Mass | 692.06 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[[2-fluoro-3-[(1-methylcyclobutyl)sulfamoylamino]phenyl]methyl]-N-methoxybenzamide |
| SMILES | CONC(=O)c1cc(Cc2cccc(NS(=O)(=O)NC3(C)CCC3)c2F)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C26H25F4IN4O4S/c1-26(9-4-10-26)35-40(37,38)34-20-6-3-5-14(21(20)28)11-15-12-17(25(36)33-39-2)24(23(30)22(15)29)32-19-8-7-16(31)13-18(19)27/h3,5-8,12-13,32,34-35H,4,9-11H2,1-2H3,(H,33,36) |
| InChIKey | LMWLLHDHDDTUEP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|