C21H18BrF4N5O4S — CID 156808833
2-(4-bromo-2-fluoroanilino)-3,4-difluoro-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]-N-methoxybenzamide (PubChem CID 156808833) has the molecular formula C21H18BrF4N5O4S and a molecular weight of 592.37 g/mol. Its IUPAC name is 2-(4-bromo-2-fluoroanilino)-3,4-difluoro-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]-N-methoxybenzamide.
| Compound Name | 2-(4-bromo-2-fluoroanilino)-3,4-difluoro-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]-N-methoxybenzamide |
|---|---|
| PubChem CID | 156808833 |
| Molecular Formula | C21H18BrF4N5O4S |
| Molecular Weight | 592.37 g/mol |
| Exact Mass | 591.02 |
| IUPAC Name | 2-(4-bromo-2-fluoroanilino)-3,4-difluoro-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]-N-methoxybenzamide |
| SMILES | CNS(=O)(=O)Nc1nccc(Cc2cc(C(=O)NOC)c(Nc3ccc(Br)cc3F)c(F)c2F)c1F |
| InChI | InChI=1S/C21H18BrF4N5O4S/c1-27-36(33,34)31-20-17(25)10(5-6-28-20)7-11-8-13(21(32)30-35-2)19(18(26)16(11)24)29-15-4-3-12(22)9-14(15)23/h3-6,8-9,27,29H,7H2,1-2H3,(H,28,31)(H,30,32) |
| InChIKey | LTRIGNNYJQRLEJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 121.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|