C21H21F2IN6O5S — CID 156808808
2-(2-fluoro-4-iodoanilino)-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]-N-methoxy-1-methyl-6-oxopyridine-3-carboxamide (PubChem CID 156808808) has the molecular formula C21H21F2IN6O5S and a molecular weight of 634.40 g/mol. Its IUPAC name is 2-(2-fluoro-4-iodoanilino)-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]-N-methoxy-1-methyl-6-oxopyridine-3-carboxamide.
| Compound Name | 2-(2-fluoro-4-iodoanilino)-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]-N-methoxy-1-methyl-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 156808808 |
| Molecular Formula | C21H21F2IN6O5S |
| Molecular Weight | 634.40 g/mol |
| Exact Mass | 634.03 |
| IUPAC Name | 2-(2-fluoro-4-iodoanilino)-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]-N-methoxy-1-methyl-6-oxopyridine-3-carboxamide |
| SMILES | CNS(=O)(=O)Nc1nccc(Cc2cc(C(=O)NOC)c(Nc3ccc(I)cc3F)n(C)c2=O)c1F |
| InChI | InChI=1S/C21H21F2IN6O5S/c1-25-36(33,34)29-18-17(23)11(6-7-26-18)8-12-9-14(20(31)28-35-3)19(30(2)21(12)32)27-16-5-4-13(24)10-15(16)22/h4-7,9-10,25,27H,8H2,1-3H3,(H,26,29)(H,28,31) |
| InChIKey | SGZHLFXKVNMWRZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 143.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|