C25H26F3IN6O5S — CID 177168334
tert-butyl N-[[4-fluoro-2-(2-fluoro-4-iodoanilino)-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]benzoyl]amino]carbamate (PubChem CID 177168334) has the molecular formula C25H26F3IN6O5S and a molecular weight of 706.48 g/mol. Its IUPAC name is tert-butyl N-[[4-fluoro-2-(2-fluoro-4-iodoanilino)-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]benzoyl]amino]carbamate.
| Compound Name | tert-butyl N-[[4-fluoro-2-(2-fluoro-4-iodoanilino)-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]benzoyl]amino]carbamate |
|---|---|
| PubChem CID | 177168334 |
| Molecular Formula | C25H26F3IN6O5S |
| Molecular Weight | 706.48 g/mol |
| Exact Mass | 706.07 |
| IUPAC Name | tert-butyl N-[[4-fluoro-2-(2-fluoro-4-iodoanilino)-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]benzoyl]amino]carbamate |
| SMILES | CNS(=O)(=O)Nc1nccc(Cc2cc(C(=O)NNC(=O)OC(C)(C)C)c(Nc3ccc(I)cc3F)cc2F)c1F |
| InChI | InChI=1S/C25H26F3IN6O5S/c1-25(2,3)40-24(37)34-33-23(36)16-10-14(9-13-7-8-31-22(21(13)28)35-41(38,39)30-4)17(26)12-20(16)32-19-6-5-15(29)11-18(19)27/h5-8,10-12,30,32H,9H2,1-4H3,(H,31,35)(H,33,36)(H,34,37) |
| InChIKey | XINKCDLJHJZLAG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 150.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|