C23H19F4IN6O3S — CID 177168338
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]-N'-prop-2-ynylbenzohydrazide (PubChem CID 177168338) has the molecular formula C23H19F4IN6O3S and a molecular weight of 662.41 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]-N'-prop-2-ynylbenzohydrazide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]-N'-prop-2-ynylbenzohydrazide |
|---|---|
| PubChem CID | 177168338 |
| Molecular Formula | C23H19F4IN6O3S |
| Molecular Weight | 662.41 g/mol |
| Exact Mass | 662.02 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]-N'-prop-2-ynylbenzohydrazide |
| SMILES | C#CCNNC(=O)c1cc(Cc2ccnc(NS(=O)(=O)NC)c2F)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C23H19F4IN6O3S/c1-3-7-31-33-23(35)15-10-13(9-12-6-8-30-22(19(12)26)34-38(36,37)29-2)18(25)20(27)21(15)32-17-5-4-14(28)11-16(17)24/h1,4-6,8,10-11,29,31-32H,7,9H2,2H3,(H,30,34)(H,33,35) |
| InChIKey | GUZSHLVYTDEVAF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 124.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|