C23H17F4IN4O — CID 170699938
5-[(2-amino-3-fluoro-4-pyridinyl)methyl]-N-[(2R)-but-3-yn-2-yl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide (PubChem CID 170699938) has the molecular formula C23H17F4IN4O and a molecular weight of 568.31 g/mol. Its IUPAC name is 5-[(2-amino-3-fluoro-4-pyridinyl)methyl]-N-[(2R)-but-3-yn-2-yl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide.
| Compound Name | 5-[(2-amino-3-fluoro-4-pyridinyl)methyl]-N-[(2R)-but-3-yn-2-yl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 170699938 |
| Molecular Formula | C23H17F4IN4O |
| Molecular Weight | 568.31 g/mol |
| Exact Mass | 568.04 |
| IUPAC Name | 5-[(2-amino-3-fluoro-4-pyridinyl)methyl]-N-[(2R)-but-3-yn-2-yl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
| SMILES | C#C[C@@H](C)NC(=O)c1cc(Cc2ccnc(N)c2F)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C23H17F4IN4O/c1-3-11(2)31-23(33)15-9-13(8-12-6-7-30-22(29)19(12)26)18(25)20(27)21(15)32-17-5-4-14(28)10-16(17)24/h1,4-7,9-11,32H,8H2,2H3,(H2,29,30)(H,31,33)/t11-/m1/s1 |
| InChIKey | ODVXTCCOXWSVSE-LLVKDONJSA-N |
| XLogP | 4.91 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.31 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|