C19H14F4IN3 — CID 170699959
4-[[2,3-difluoro-4-(2-fluoro-4-iodoanilino)-5-methylphenyl]methyl]-3-fluoropyridin-2-amine (PubChem CID 170699959) has the molecular formula C19H14F4IN3 and a molecular weight of 487.24 g/mol. Its IUPAC name is 4-[[2,3-difluoro-4-(2-fluoro-4-iodoanilino)-5-methylphenyl]methyl]-3-fluoropyridin-2-amine.
| Compound Name | 4-[[2,3-difluoro-4-(2-fluoro-4-iodoanilino)-5-methylphenyl]methyl]-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 170699959 |
| Molecular Formula | C19H14F4IN3 |
| Molecular Weight | 487.24 g/mol |
| Exact Mass | 487.02 |
| IUPAC Name | 4-[[2,3-difluoro-4-(2-fluoro-4-iodoanilino)-5-methylphenyl]methyl]-3-fluoropyridin-2-amine |
| SMILES | Cc1cc(Cc2ccnc(N)c2F)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C19H14F4IN3/c1-9-6-11(7-10-4-5-26-19(25)16(10)22)15(21)17(23)18(9)27-14-3-2-12(24)8-13(14)20/h2-6,8,27H,7H2,1H3,(H2,25,26) |
| InChIKey | BPVVZICFYJSQTK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.24 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|