C21H19F3IN5O3S — CID 156808768
5-[[2-(ethylsulfamoylamino)-3-fluoro-4-pyridinyl]methyl]-4-fluoro-2-(2-fluoro-4-iodoanilino)benzamide (PubChem CID 156808768) has the molecular formula C21H19F3IN5O3S and a molecular weight of 605.38 g/mol. Its IUPAC name is 5-[[2-(ethylsulfamoylamino)-3-fluoro-4-pyridinyl]methyl]-4-fluoro-2-(2-fluoro-4-iodoanilino)benzamide.
| Compound Name | 5-[[2-(ethylsulfamoylamino)-3-fluoro-4-pyridinyl]methyl]-4-fluoro-2-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 156808768 |
| Molecular Formula | C21H19F3IN5O3S |
| Molecular Weight | 605.38 g/mol |
| Exact Mass | 605.02 |
| IUPAC Name | 5-[[2-(ethylsulfamoylamino)-3-fluoro-4-pyridinyl]methyl]-4-fluoro-2-(2-fluoro-4-iodoanilino)benzamide |
| SMILES | CCNS(=O)(=O)Nc1nccc(Cc2cc(C(N)=O)c(Nc3ccc(I)cc3F)cc2F)c1F |
| InChI | InChI=1S/C21H19F3IN5O3S/c1-2-28-34(32,33)30-21-19(24)11(5-6-27-21)7-12-8-14(20(26)31)18(10-15(12)22)29-17-4-3-13(25)9-16(17)23/h3-6,8-10,28-29H,2,7H2,1H3,(H2,26,31)(H,27,30) |
| InChIKey | GPQZSOKVRXFLTO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|