C17H14F3IN2O2 — CID 176716521
5-cyclopropyl-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-methoxybenzamide (PubChem CID 176716521) has the molecular formula C17H14F3IN2O2 and a molecular weight of 462.21 g/mol. Its IUPAC name is 5-cyclopropyl-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-methoxybenzamide.
| Compound Name | 5-cyclopropyl-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-methoxybenzamide |
|---|---|
| PubChem CID | 176716521 |
| Molecular Formula | C17H14F3IN2O2 |
| Molecular Weight | 462.21 g/mol |
| Exact Mass | 462.01 |
| IUPAC Name | 5-cyclopropyl-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-methoxybenzamide |
| SMILES | CONC(=O)c1cc(C2CC2)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C17H14F3IN2O2/c1-25-23-17(24)11-7-10(8-2-3-8)14(19)15(20)16(11)22-13-5-4-9(21)6-12(13)18/h4-8,22H,2-3H2,1H3,(H,23,24) |
| InChIKey | WMBACEJTOQKTLD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.21 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|