C15H9F3INO3 — CID 156808966
methyl 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-formylbenzoate (PubChem CID 156808966) has the molecular formula C15H9F3INO3 and a molecular weight of 435.14 g/mol. Its IUPAC name is methyl 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-formylbenzoate.
| Compound Name | methyl 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-formylbenzoate |
|---|---|
| PubChem CID | 156808966 |
| Molecular Formula | C15H9F3INO3 |
| Molecular Weight | 435.14 g/mol |
| Exact Mass | 434.96 |
| IUPAC Name | methyl 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-formylbenzoate |
| SMILES | COC(=O)c1cc(C=O)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C15H9F3INO3/c1-23-15(22)9-4-7(6-21)12(17)13(18)14(9)20-11-3-2-8(19)5-10(11)16/h2-6,20H,1H3 |
| InChIKey | ZLZGRBCCANMBTP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.14 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|