C22H25F3IN2O4Si — CID 87834199
CID 87834199 (PubChem CID 87834199) has the molecular formula C22H25F3IN2O4Si and a molecular weight of 593.44 g/mol.
| Compound Name | CID 87834199 |
|---|---|
| PubChem CID | 87834199 |
| Molecular Formula | C22H25F3IN2O4Si |
| Molecular Weight | 593.44 g/mol |
| Exact Mass | 593.06 |
| IUPAC Name | — |
| SMILES | C[Si](C)OC(CONC(=O)c1cc(C=O)c(F)c(F)c1Nc1ccc(I)cc1F)C(C)(C)C |
| InChI | InChI=1S/C22H25F3IN2O4Si/c1-22(2,3)17(32-33(4)5)11-31-28-21(30)14-8-12(10-29)18(24)19(25)20(14)27-16-7-6-13(26)9-15(16)23/h6-10,17,27H,11H2,1-5H3,(H,28,30) |
| InChIKey | YBYWVEHNLFEZPQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|