C17H15BrF3IN2O4 — CID 22286269
5-bromo-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxy-3-methoxypropoxy)benzamide (PubChem CID 22286269) has the molecular formula C17H15BrF3IN2O4 and a molecular weight of 575.12 g/mol. Its IUPAC name is 5-bromo-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxy-3-methoxypropoxy)benzamide.
| Compound Name | 5-bromo-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxy-3-methoxypropoxy)benzamide |
|---|---|
| PubChem CID | 22286269 |
| Molecular Formula | C17H15BrF3IN2O4 |
| Molecular Weight | 575.12 g/mol |
| Exact Mass | 573.92 |
| IUPAC Name | 5-bromo-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxy-3-methoxypropoxy)benzamide |
| SMILES | COCC(O)CONC(=O)c1cc(Br)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C17H15BrF3IN2O4/c1-27-6-9(25)7-28-24-17(26)10-5-11(18)14(20)15(21)16(10)23-13-3-2-8(22)4-12(13)19/h2-5,9,23,25H,6-7H2,1H3,(H,24,26) |
| InChIKey | NJULSZSBBCZLKJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.12 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|