C16H9F6IN2O4 — CID 141148932
(2,2,2-trifluoroacetyl) 5-(aminomethyl)-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzenecarboperoxoate (PubChem CID 141148932) has the molecular formula C16H9F6IN2O4 and a molecular weight of 534.15 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 5-(aminomethyl)-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzenecarboperoxoate.
| Compound Name | (2,2,2-trifluoroacetyl) 5-(aminomethyl)-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzenecarboperoxoate |
|---|---|
| PubChem CID | 141148932 |
| Molecular Formula | C16H9F6IN2O4 |
| Molecular Weight | 534.15 g/mol |
| Exact Mass | 533.95 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 5-(aminomethyl)-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzenecarboperoxoate |
| SMILES | NCc1cc(C(=O)OOC(=O)C(F)(F)F)c(Nc2ccc(I)cc2F)c(F)c1F |
| InChI | InChI=1S/C16H9F6IN2O4/c17-9-4-7(23)1-2-10(9)25-13-8(3-6(5-24)11(18)12(13)19)14(26)28-29-15(27)16(20,21)22/h1-4,25H,5,24H2 |
| InChIKey | VRJAMSPVQPHGNY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.15 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|