C23H19F5IN3O3S — CID 156808773
3,4-difluoro-5-[[2-fluoro-3-(3-fluoropropylsulfonylamino)phenyl]methyl]-2-(2-fluoro-4-iodoanilino)benzamide (PubChem CID 156808773) has the molecular formula C23H19F5IN3O3S and a molecular weight of 639.38 g/mol. Its IUPAC name is 3,4-difluoro-5-[[2-fluoro-3-(3-fluoropropylsulfonylamino)phenyl]methyl]-2-(2-fluoro-4-iodoanilino)benzamide.
| Compound Name | 3,4-difluoro-5-[[2-fluoro-3-(3-fluoropropylsulfonylamino)phenyl]methyl]-2-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 156808773 |
| Molecular Formula | C23H19F5IN3O3S |
| Molecular Weight | 639.38 g/mol |
| Exact Mass | 639.01 |
| IUPAC Name | 3,4-difluoro-5-[[2-fluoro-3-(3-fluoropropylsulfonylamino)phenyl]methyl]-2-(2-fluoro-4-iodoanilino)benzamide |
| SMILES | NC(=O)c1cc(Cc2cccc(NS(=O)(=O)CCCF)c2F)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C23H19F5IN3O3S/c24-7-2-8-36(34,35)32-18-4-1-3-12(19(18)26)9-13-10-15(23(30)33)22(21(28)20(13)27)31-17-6-5-14(29)11-16(17)25/h1,3-6,10-11,31-32H,2,7-9H2,(H2,30,33) |
| InChIKey | JGXHQMQPGIDNQB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.38 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|