C22H19F3IN3O3S — CID 156808979
5-[[3-(ethylsulfonylamino)phenyl]methyl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide (PubChem CID 156808979) has the molecular formula C22H19F3IN3O3S and a molecular weight of 589.38 g/mol. Its IUPAC name is 5-[[3-(ethylsulfonylamino)phenyl]methyl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide.
| Compound Name | 5-[[3-(ethylsulfonylamino)phenyl]methyl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 156808979 |
| Molecular Formula | C22H19F3IN3O3S |
| Molecular Weight | 589.38 g/mol |
| Exact Mass | 589.01 |
| IUPAC Name | 5-[[3-(ethylsulfonylamino)phenyl]methyl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzamide |
| SMILES | CCS(=O)(=O)Nc1cccc(Cc2cc(C(N)=O)c(Nc3ccc(I)cc3F)c(F)c2F)c1 |
| InChI | InChI=1S/C22H19F3IN3O3S/c1-2-33(31,32)29-15-5-3-4-12(9-15)8-13-10-16(22(27)30)21(20(25)19(13)24)28-18-7-6-14(26)11-17(18)23/h3-7,9-11,28-29H,2,8H2,1H3,(H2,27,30) |
| InChIKey | GUGQTZDITULCAM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.38 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|