C20H18F2IN3O3S — CID 67073699
N-[3-[2-amino-3-fluoro-5-(2-fluoro-4-iodoanilino)phenoxy]phenyl]ethanesulfonamide (PubChem CID 67073699) has the molecular formula C20H18F2IN3O3S and a molecular weight of 545.35 g/mol. Its IUPAC name is N-[3-[2-amino-3-fluoro-5-(2-fluoro-4-iodoanilino)phenoxy]phenyl]ethanesulfonamide.
| Compound Name | N-[3-[2-amino-3-fluoro-5-(2-fluoro-4-iodoanilino)phenoxy]phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 67073699 |
| Molecular Formula | C20H18F2IN3O3S |
| Molecular Weight | 545.35 g/mol |
| Exact Mass | 545.01 |
| IUPAC Name | N-[3-[2-amino-3-fluoro-5-(2-fluoro-4-iodoanilino)phenoxy]phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1cccc(Oc2cc(Nc3ccc(I)cc3F)cc(F)c2N)c1 |
| InChI | InChI=1S/C20H18F2IN3O3S/c1-2-30(27,28)26-13-4-3-5-15(9-13)29-19-11-14(10-17(22)20(19)24)25-18-7-6-12(23)8-16(18)21/h3-11,25-26H,2,24H2,1H3 |
| InChIKey | PMBJMAFQPWRRPJ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.35 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|