C23H23F2IN4O4S — CID 66909305
2-[3-(diethylsulfamoylamino)phenoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide (PubChem CID 66909305) has the molecular formula C23H23F2IN4O4S and a molecular weight of 616.43 g/mol. Its IUPAC name is 2-[3-(diethylsulfamoylamino)phenoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide.
| Compound Name | 2-[3-(diethylsulfamoylamino)phenoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 66909305 |
| Molecular Formula | C23H23F2IN4O4S |
| Molecular Weight | 616.43 g/mol |
| Exact Mass | 616.05 |
| IUPAC Name | 2-[3-(diethylsulfamoylamino)phenoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide |
| SMILES | CCN(CC)S(=O)(=O)Nc1cccc(Oc2cc(F)cc(Nc3ccc(I)cc3F)c2C(N)=O)c1 |
| InChI | InChI=1S/C23H23F2IN4O4S/c1-3-30(4-2)35(32,33)29-16-6-5-7-17(13-16)34-21-11-14(24)10-20(22(21)23(27)31)28-19-9-8-15(26)12-18(19)25/h5-13,28-29H,3-4H2,1-2H3,(H2,27,31) |
| InChIKey | JHTIEQCIHUFENS-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.43 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|