C25H22F2IN3O3 — CID 66909312
2-[3-(cyclopentanecarbonylamino)phenoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide (PubChem CID 66909312) has the molecular formula C25H22F2IN3O3 and a molecular weight of 577.37 g/mol. Its IUPAC name is 2-[3-(cyclopentanecarbonylamino)phenoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide.
| Compound Name | 2-[3-(cyclopentanecarbonylamino)phenoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 66909312 |
| Molecular Formula | C25H22F2IN3O3 |
| Molecular Weight | 577.37 g/mol |
| Exact Mass | 577.07 |
| IUPAC Name | 2-[3-(cyclopentanecarbonylamino)phenoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide |
| SMILES | NC(=O)c1c(Nc2ccc(I)cc2F)cc(F)cc1Oc1cccc(NC(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C25H22F2IN3O3/c26-15-10-21(31-20-9-8-16(28)12-19(20)27)23(24(29)32)22(11-15)34-18-7-3-6-17(13-18)30-25(33)14-4-1-2-5-14/h3,6-14,31H,1-2,4-5H2,(H2,29,32)(H,30,33) |
| InChIKey | FBBVCAGOBKMRMN-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.37 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|