C19H20F2IN3O4S — CID 66919915
4-fluoro-2-(2-fluoro-4-iodoanilino)-6-[(1-methylsulfonylpyrrolidin-2-yl)methoxy]benzamide (PubChem CID 66919915) has the molecular formula C19H20F2IN3O4S and a molecular weight of 551.35 g/mol. Its IUPAC name is 4-fluoro-2-(2-fluoro-4-iodoanilino)-6-[(1-methylsulfonylpyrrolidin-2-yl)methoxy]benzamide.
| Compound Name | 4-fluoro-2-(2-fluoro-4-iodoanilino)-6-[(1-methylsulfonylpyrrolidin-2-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 66919915 |
| Molecular Formula | C19H20F2IN3O4S |
| Molecular Weight | 551.35 g/mol |
| Exact Mass | 551.02 |
| IUPAC Name | 4-fluoro-2-(2-fluoro-4-iodoanilino)-6-[(1-methylsulfonylpyrrolidin-2-yl)methoxy]benzamide |
| SMILES | CS(=O)(=O)N1CCCC1COc1cc(F)cc(Nc2ccc(I)cc2F)c1C(N)=O |
| InChI | InChI=1S/C19H20F2IN3O4S/c1-30(27,28)25-6-2-3-13(25)10-29-17-8-11(20)7-16(18(17)19(23)26)24-15-5-4-12(22)9-14(15)21/h4-5,7-9,13,24H,2-3,6,10H2,1H3,(H2,23,26) |
| InChIKey | XEUSGKAWDGIKEG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|