C26H26F2IN5O3 — CID 46196196
4-fluoro-2-(2-fluoro-4-iodoanilino)-6-[3-[[2-(4-methylpiperazin-1-yl)acetyl]amino]phenoxy]benzamide (PubChem CID 46196196) has the molecular formula C26H26F2IN5O3 and a molecular weight of 621.43 g/mol. Its IUPAC name is 4-fluoro-2-(2-fluoro-4-iodoanilino)-6-[3-[[2-(4-methylpiperazin-1-yl)acetyl]amino]phenoxy]benzamide.
| Compound Name | 4-fluoro-2-(2-fluoro-4-iodoanilino)-6-[3-[[2-(4-methylpiperazin-1-yl)acetyl]amino]phenoxy]benzamide |
|---|---|
| PubChem CID | 46196196 |
| Molecular Formula | C26H26F2IN5O3 |
| Molecular Weight | 621.43 g/mol |
| Exact Mass | 621.10 |
| IUPAC Name | 4-fluoro-2-(2-fluoro-4-iodoanilino)-6-[3-[[2-(4-methylpiperazin-1-yl)acetyl]amino]phenoxy]benzamide |
| SMILES | CN1CCN(CC(=O)Nc2cccc(Oc3cc(F)cc(Nc4ccc(I)cc4F)c3C(N)=O)c2)CC1 |
| InChI | InChI=1S/C26H26F2IN5O3/c1-33-7-9-34(10-8-33)15-24(35)31-18-3-2-4-19(14-18)37-23-12-16(27)11-22(25(23)26(30)36)32-21-6-5-17(29)13-20(21)28/h2-6,11-14,32H,7-10,15H2,1H3,(H2,30,36)(H,31,35) |
| InChIKey | XJNWJGKZMBBRGU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|