C21H25FN4O3 — CID 7336695
N-(4-fluorophenyl)-2-[4-[2-(3-methoxyanilino)-2-oxoethyl]piperazin-1-yl]acetamide (PubChem CID 7336695) has the molecular formula C21H25FN4O3 and a molecular weight of 400.45 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[4-[2-(3-methoxyanilino)-2-oxoethyl]piperazin-1-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[4-[2-(3-methoxyanilino)-2-oxoethyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 7336695 |
| Molecular Formula | C21H25FN4O3 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N-(4-fluorophenyl)-2-[4-[2-(3-methoxyanilino)-2-oxoethyl]piperazin-1-yl]acetamide |
| SMILES | COc1cccc(NC(=O)CN2CCN(CC(=O)Nc3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C21H25FN4O3/c1-29-19-4-2-3-18(13-19)24-21(28)15-26-11-9-25(10-12-26)14-20(27)23-17-7-5-16(22)6-8-17/h2-8,13H,9-12,14-15H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | SNWSPYRBRZFAAW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |