C21H25N3O3 — CID 1443713
2-[4-(4-acetylphenyl)piperazin-1-yl]-N-(3-methoxyphenyl)acetamide (PubChem CID 1443713) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-[4-(4-acetylphenyl)piperazin-1-yl]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[4-(4-acetylphenyl)piperazin-1-yl]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 1443713 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2-[4-(4-acetylphenyl)piperazin-1-yl]-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)CN2CCN(c3ccc(C(C)=O)cc3)CC2)c1 |
| InChI | InChI=1S/C21H25N3O3/c1-16(25)17-6-8-19(9-7-17)24-12-10-23(11-13-24)15-21(26)22-18-4-3-5-20(14-18)27-2/h3-9,14H,10-13,15H2,1-2H3,(H,22,26) |
| InChIKey | XPHRMYFTIVAEMP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |