C24H20F2IN3O5 — CID 46196200
methyl 4-[3-[2-carbamoyl-5-fluoro-3-(2-fluoro-4-iodoanilino)phenoxy]anilino]-4-oxobutanoate (PubChem CID 46196200) has the molecular formula C24H20F2IN3O5 and a molecular weight of 595.34 g/mol. Its IUPAC name is methyl 4-[3-[2-carbamoyl-5-fluoro-3-(2-fluoro-4-iodoanilino)phenoxy]anilino]-4-oxobutanoate.
| Compound Name | methyl 4-[3-[2-carbamoyl-5-fluoro-3-(2-fluoro-4-iodoanilino)phenoxy]anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 46196200 |
| Molecular Formula | C24H20F2IN3O5 |
| Molecular Weight | 595.34 g/mol |
| Exact Mass | 595.04 |
| IUPAC Name | methyl 4-[3-[2-carbamoyl-5-fluoro-3-(2-fluoro-4-iodoanilino)phenoxy]anilino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)Nc1cccc(Oc2cc(F)cc(Nc3ccc(I)cc3F)c2C(N)=O)c1 |
| InChI | InChI=1S/C24H20F2IN3O5/c1-34-22(32)8-7-21(31)29-15-3-2-4-16(12-15)35-20-10-13(25)9-19(23(20)24(28)33)30-18-6-5-14(27)11-17(18)26/h2-6,9-12,30H,7-8H2,1H3,(H2,28,33)(H,29,31) |
| InChIKey | KGTCOHZMRIZHQQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.34 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|