C22H20F2IN3O4S — CID 46195696
2-[[3-(ethylsulfonylamino)phenyl]methoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide (PubChem CID 46195696) has the molecular formula C22H20F2IN3O4S and a molecular weight of 587.39 g/mol. Its IUPAC name is 2-[[3-(ethylsulfonylamino)phenyl]methoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide.
| Compound Name | 2-[[3-(ethylsulfonylamino)phenyl]methoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 46195696 |
| Molecular Formula | C22H20F2IN3O4S |
| Molecular Weight | 587.39 g/mol |
| Exact Mass | 587.02 |
| IUPAC Name | 2-[[3-(ethylsulfonylamino)phenyl]methoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide |
| SMILES | CCS(=O)(=O)Nc1cccc(COc2cc(F)cc(Nc3ccc(I)cc3F)c2C(N)=O)c1 |
| InChI | InChI=1S/C22H20F2IN3O4S/c1-2-33(30,31)28-16-5-3-4-13(8-16)12-32-20-10-14(23)9-19(21(20)22(26)29)27-18-7-6-15(25)11-17(18)24/h3-11,27-28H,2,12H2,1H3,(H2,26,29) |
| InChIKey | VGWTUBLTDIHQBM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.39 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|