C23H22F2IN3O4S — CID 118401783
2-[[3-(ethylsulfamoylmethyl)phenyl]methoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide (PubChem CID 118401783) has the molecular formula C23H22F2IN3O4S and a molecular weight of 601.41 g/mol. Its IUPAC name is 2-[[3-(ethylsulfamoylmethyl)phenyl]methoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide.
| Compound Name | 2-[[3-(ethylsulfamoylmethyl)phenyl]methoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 118401783 |
| Molecular Formula | C23H22F2IN3O4S |
| Molecular Weight | 601.41 g/mol |
| Exact Mass | 601.03 |
| IUPAC Name | 2-[[3-(ethylsulfamoylmethyl)phenyl]methoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide |
| SMILES | CCNS(=O)(=O)Cc1cccc(COc2cc(F)cc(Nc3ccc(I)cc3F)c2C(N)=O)c1 |
| InChI | InChI=1S/C23H22F2IN3O4S/c1-2-28-34(31,32)13-15-5-3-4-14(8-15)12-33-21-10-16(24)9-20(22(21)23(27)30)29-19-7-6-17(26)11-18(19)25/h3-11,28-29H,2,12-13H2,1H3,(H2,27,30) |
| InChIKey | XARYAWKCNPWSEI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|