C21H18F2IN3O2 — CID 67413643
2-[3-(2-aminoethyl)phenoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide (PubChem CID 67413643) has the molecular formula C21H18F2IN3O2 and a molecular weight of 509.29 g/mol. Its IUPAC name is 2-[3-(2-aminoethyl)phenoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide.
| Compound Name | 2-[3-(2-aminoethyl)phenoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 67413643 |
| Molecular Formula | C21H18F2IN3O2 |
| Molecular Weight | 509.29 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | 2-[3-(2-aminoethyl)phenoxy]-4-fluoro-6-(2-fluoro-4-iodoanilino)benzamide |
| SMILES | NCCc1cccc(Oc2cc(F)cc(Nc3ccc(I)cc3F)c2C(N)=O)c1 |
| InChI | InChI=1S/C21H18F2IN3O2/c22-13-9-18(27-17-5-4-14(24)11-16(17)23)20(21(26)28)19(10-13)29-15-3-1-2-12(8-15)6-7-25/h1-5,8-11,27H,6-7,25H2,(H2,26,28) |
| InChIKey | VYQXLPJVMDFFKG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.29 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|