C13H8F3IN2O — CID 71580064
2,4-difluoro-6-(2-fluoro-4-iodoanilino)benzamide (PubChem CID 71580064) has the molecular formula C13H8F3IN2O and a molecular weight of 392.12 g/mol. Its IUPAC name is 2,4-difluoro-6-(2-fluoro-4-iodoanilino)benzamide.
| Compound Name | 2,4-difluoro-6-(2-fluoro-4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 71580064 |
| Molecular Formula | C13H8F3IN2O |
| Molecular Weight | 392.12 g/mol |
| Exact Mass | 391.96 |
| IUPAC Name | 2,4-difluoro-6-(2-fluoro-4-iodoanilino)benzamide |
| SMILES | NC(=O)c1c(F)cc(F)cc1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C13H8F3IN2O/c14-6-3-9(16)12(13(18)20)11(4-6)19-10-2-1-7(17)5-8(10)15/h1-5,19H,(H2,18,20) |
| InChIKey | LNWNUFKJPPVYCH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.12 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|