C20H20F2IN3O4 — CID 140561749
[4-[2-carbamoyl-5-fluoro-3-(2-fluoro-4-iodoanilino)phenoxy]cyclohexyl]carbamic acid (PubChem CID 140561749) has the molecular formula C20H20F2IN3O4 and a molecular weight of 531.30 g/mol. Its IUPAC name is [4-[2-carbamoyl-5-fluoro-3-(2-fluoro-4-iodoanilino)phenoxy]cyclohexyl]carbamic acid.
| Compound Name | [4-[2-carbamoyl-5-fluoro-3-(2-fluoro-4-iodoanilino)phenoxy]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 140561749 |
| Molecular Formula | C20H20F2IN3O4 |
| Molecular Weight | 531.30 g/mol |
| Exact Mass | 531.05 |
| IUPAC Name | [4-[2-carbamoyl-5-fluoro-3-(2-fluoro-4-iodoanilino)phenoxy]cyclohexyl]carbamic acid |
| SMILES | NC(=O)c1c(Nc2ccc(I)cc2F)cc(F)cc1OC1CCC(NC(=O)O)CC1 |
| InChI | InChI=1S/C20H20F2IN3O4/c21-10-7-16(26-15-6-1-11(23)9-14(15)22)18(19(24)27)17(8-10)30-13-4-2-12(3-5-13)25-20(28)29/h1,6-9,12-13,25-26H,2-5H2,(H2,24,27)(H,28,29) |
| InChIKey | VADQHNKVFOXBAB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|