C21H17F2IN4O5S — CID 127041604
4-fluoro-2-(2-fluoro-4-iodoanilino)-6-[(4-sulfamoyl-2,3-dihydro-1,4-benzoxazin-6-yl)oxy]benzamide (PubChem CID 127041604) has the molecular formula C21H17F2IN4O5S and a molecular weight of 602.36 g/mol. Its IUPAC name is 4-fluoro-2-(2-fluoro-4-iodoanilino)-6-[(4-sulfamoyl-2,3-dihydro-1,4-benzoxazin-6-yl)oxy]benzamide.
| Compound Name | 4-fluoro-2-(2-fluoro-4-iodoanilino)-6-[(4-sulfamoyl-2,3-dihydro-1,4-benzoxazin-6-yl)oxy]benzamide |
|---|---|
| PubChem CID | 127041604 |
| Molecular Formula | C21H17F2IN4O5S |
| Molecular Weight | 602.36 g/mol |
| Exact Mass | 601.99 |
| IUPAC Name | 4-fluoro-2-(2-fluoro-4-iodoanilino)-6-[(4-sulfamoyl-2,3-dihydro-1,4-benzoxazin-6-yl)oxy]benzamide |
| SMILES | NC(=O)c1c(Nc2ccc(I)cc2F)cc(F)cc1Oc1ccc2c(c1)N(S(N)(=O)=O)CCO2 |
| InChI | InChI=1S/C21H17F2IN4O5S/c22-11-7-16(27-15-3-1-12(24)9-14(15)23)20(21(25)29)19(8-11)33-13-2-4-18-17(10-13)28(5-6-32-18)34(26,30)31/h1-4,7-10,27H,5-6H2,(H2,25,29)(H2,26,30,31) |
| InChIKey | ZCFDLWBHRWQWGA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|