C22H20F2IN3O5S2 — CID 52913947
N-[4-fluoro-2-(2-fluoro-4-iodoanilino)-6-[3-(methanesulfonamido)phenoxy]phenyl]cyclopropanesulfonamide (PubChem CID 52913947) has the molecular formula C22H20F2IN3O5S2 and a molecular weight of 635.45 g/mol. Its IUPAC name is N-[4-fluoro-2-(2-fluoro-4-iodoanilino)-6-[3-(methanesulfonamido)phenoxy]phenyl]cyclopropanesulfonamide.
| Compound Name | N-[4-fluoro-2-(2-fluoro-4-iodoanilino)-6-[3-(methanesulfonamido)phenoxy]phenyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 52913947 |
| Molecular Formula | C22H20F2IN3O5S2 |
| Molecular Weight | 635.45 g/mol |
| Exact Mass | 634.99 |
| IUPAC Name | N-[4-fluoro-2-(2-fluoro-4-iodoanilino)-6-[3-(methanesulfonamido)phenoxy]phenyl]cyclopropanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(Oc2cc(F)cc(Nc3ccc(I)cc3F)c2NS(=O)(=O)C2CC2)c1 |
| InChI | InChI=1S/C22H20F2IN3O5S2/c1-34(29,30)27-15-3-2-4-16(12-15)33-21-10-13(23)9-20(22(21)28-35(31,32)17-6-7-17)26-19-8-5-14(25)11-18(19)24/h2-5,8-12,17,26-28H,6-7H2,1H3 |
| InChIKey | MLZHZPPROKLAIZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|