C23H22F2N4O7S2 — CID 52914056
N-[3-[3-(4-ethynyl-2-fluoroanilino)-5-fluoro-2-(sulfamoylamino)phenoxy]phenyl]ethanesulfonamide;formic acid (PubChem CID 52914056) has the molecular formula C23H22F2N4O7S2 and a molecular weight of 568.58 g/mol. Its IUPAC name is N-[3-[3-(4-ethynyl-2-fluoroanilino)-5-fluoro-2-(sulfamoylamino)phenoxy]phenyl]ethanesulfonamide;formic acid.
| Compound Name | N-[3-[3-(4-ethynyl-2-fluoroanilino)-5-fluoro-2-(sulfamoylamino)phenoxy]phenyl]ethanesulfonamide;formic acid |
|---|---|
| PubChem CID | 52914056 |
| Molecular Formula | C23H22F2N4O7S2 |
| Molecular Weight | 568.58 g/mol |
| Exact Mass | 568.09 |
| IUPAC Name | N-[3-[3-(4-ethynyl-2-fluoroanilino)-5-fluoro-2-(sulfamoylamino)phenoxy]phenyl]ethanesulfonamide;formic acid |
| SMILES | C#Cc1ccc(Nc2cc(F)cc(Oc3cccc(NS(=O)(=O)CC)c3)c2NS(N)(=O)=O)c(F)c1.O=CO |
| InChI | InChI=1S/C22H20F2N4O5S2.CH2O2/c1-3-14-8-9-19(18(24)10-14)26-20-11-15(23)12-21(22(20)28-35(25,31)32)33-17-7-5-6-16(13-17)27-34(29,30)4-2;2-1-3/h1,5-13,26-28H,4H2,2H3,(H2,25,31,32);1H,(H,2,3) |
| InChIKey | AUDUDWJPZTXZTN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 176.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.58 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|