C25H25F2N3O3S — CID 123383195
N-[2-(3-aminophenoxy)-4-fluoro-6-(2-fluoro-4-methylanilino)phenyl]-1-prop-2-enylcyclopropane-1-sulfonamide (PubChem CID 123383195) has the molecular formula C25H25F2N3O3S and a molecular weight of 485.56 g/mol. Its IUPAC name is N-[2-(3-aminophenoxy)-4-fluoro-6-(2-fluoro-4-methylanilino)phenyl]-1-prop-2-enylcyclopropane-1-sulfonamide.
| Compound Name | N-[2-(3-aminophenoxy)-4-fluoro-6-(2-fluoro-4-methylanilino)phenyl]-1-prop-2-enylcyclopropane-1-sulfonamide |
|---|---|
| PubChem CID | 123383195 |
| Molecular Formula | C25H25F2N3O3S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | N-[2-(3-aminophenoxy)-4-fluoro-6-(2-fluoro-4-methylanilino)phenyl]-1-prop-2-enylcyclopropane-1-sulfonamide |
| SMILES | C=CCC1(S(=O)(=O)Nc2c(Nc3ccc(C)cc3F)cc(F)cc2Oc2cccc(N)c2)CC1 |
| InChI | InChI=1S/C25H25F2N3O3S/c1-3-9-25(10-11-25)34(31,32)30-24-22(29-21-8-7-16(2)12-20(21)27)13-17(26)14-23(24)33-19-6-4-5-18(28)15-19/h3-8,12-15,29-30H,1,9-11,28H2,2H3 |
| InChIKey | YURSUCMLZCBCNZ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|