C20H21F3N2O3S — CID 118411308
N-[3,4-difluoro-2-(2-fluoro-4-methylanilino)-6-methoxyphenyl]-1-prop-2-enylcyclopropane-1-sulfonamide (PubChem CID 118411308) has the molecular formula C20H21F3N2O3S and a molecular weight of 426.46 g/mol. Its IUPAC name is N-[3,4-difluoro-2-(2-fluoro-4-methylanilino)-6-methoxyphenyl]-1-prop-2-enylcyclopropane-1-sulfonamide.
| Compound Name | N-[3,4-difluoro-2-(2-fluoro-4-methylanilino)-6-methoxyphenyl]-1-prop-2-enylcyclopropane-1-sulfonamide |
|---|---|
| PubChem CID | 118411308 |
| Molecular Formula | C20H21F3N2O3S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | N-[3,4-difluoro-2-(2-fluoro-4-methylanilino)-6-methoxyphenyl]-1-prop-2-enylcyclopropane-1-sulfonamide |
| SMILES | C=CCC1(S(=O)(=O)Nc2c(OC)cc(F)c(F)c2Nc2ccc(C)cc2F)CC1 |
| InChI | InChI=1S/C20H21F3N2O3S/c1-4-7-20(8-9-20)29(26,27)25-18-16(28-3)11-14(22)17(23)19(18)24-15-6-5-12(2)10-13(15)21/h4-6,10-11,24-25H,1,7-9H2,2-3H3 |
| InChIKey | ZNBJGJLFAXMOTB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|