C23H29F3N2O2S — CID 143758011
N-[3,4-difluoro-2-(2-fluoro-4-methylanilino)-6-methoxyphenyl]-1-hexylcyclopropane-1-sulfinamide (PubChem CID 143758011) has the molecular formula C23H29F3N2O2S and a molecular weight of 454.56 g/mol. Its IUPAC name is N-[3,4-difluoro-2-(2-fluoro-4-methylanilino)-6-methoxyphenyl]-1-hexylcyclopropane-1-sulfinamide.
| Compound Name | N-[3,4-difluoro-2-(2-fluoro-4-methylanilino)-6-methoxyphenyl]-1-hexylcyclopropane-1-sulfinamide |
|---|---|
| PubChem CID | 143758011 |
| Molecular Formula | C23H29F3N2O2S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | N-[3,4-difluoro-2-(2-fluoro-4-methylanilino)-6-methoxyphenyl]-1-hexylcyclopropane-1-sulfinamide |
| SMILES | CCCCCCC1(S(=O)Nc2c(OC)cc(F)c(F)c2Nc2ccc(C)cc2F)CC1 |
| InChI | InChI=1S/C23H29F3N2O2S/c1-4-5-6-7-10-23(11-12-23)31(29)28-21-19(30-3)14-17(25)20(26)22(21)27-18-9-8-15(2)13-16(18)24/h8-9,13-14,27-28H,4-7,10-12H2,1-3H3 |
| InChIKey | YSJUQJIONIVRSS-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|