C18H19F3IN3O4S — CID 24765441
2-[1-[[3,4-difluoro-2-(2-fluoro-4-iodoanilino)-6-methoxyphenyl]sulfamoylamino]cyclopropyl]ethanol (PubChem CID 24765441) has the molecular formula C18H19F3IN3O4S and a molecular weight of 557.33 g/mol. Its IUPAC name is 2-[1-[[3,4-difluoro-2-(2-fluoro-4-iodoanilino)-6-methoxyphenyl]sulfamoylamino]cyclopropyl]ethanol.
| Compound Name | 2-[1-[[3,4-difluoro-2-(2-fluoro-4-iodoanilino)-6-methoxyphenyl]sulfamoylamino]cyclopropyl]ethanol |
|---|---|
| PubChem CID | 24765441 |
| Molecular Formula | C18H19F3IN3O4S |
| Molecular Weight | 557.33 g/mol |
| Exact Mass | 557.01 |
| IUPAC Name | 2-[1-[[3,4-difluoro-2-(2-fluoro-4-iodoanilino)-6-methoxyphenyl]sulfamoylamino]cyclopropyl]ethanol |
| SMILES | COc1cc(F)c(F)c(Nc2ccc(I)cc2F)c1NS(=O)(=O)NC1(CCO)CC1 |
| InChI | InChI=1S/C18H19F3IN3O4S/c1-29-14-9-12(20)15(21)17(23-13-3-2-10(22)8-11(13)19)16(14)24-30(27,28)25-18(4-5-18)6-7-26/h2-3,8-9,23-26H,4-7H2,1H3 |
| InChIKey | MIUKHYIMZSBSAU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|