C20H22F3IN4O2S — CID 24765357
2-N-[(1-but-3-enylcyclopropyl)sulfamoyl]-4,5-difluoro-3-N-(2-fluoro-4-iodophenyl)-1-N-methylbenzene-1,2,3-triamine (PubChem CID 24765357) has the molecular formula C20H22F3IN4O2S and a molecular weight of 566.39 g/mol. Its IUPAC name is 2-N-[(1-but-3-enylcyclopropyl)sulfamoyl]-4,5-difluoro-3-N-(2-fluoro-4-iodophenyl)-1-N-methylbenzene-1,2,3-triamine.
| Compound Name | 2-N-[(1-but-3-enylcyclopropyl)sulfamoyl]-4,5-difluoro-3-N-(2-fluoro-4-iodophenyl)-1-N-methylbenzene-1,2,3-triamine |
|---|---|
| PubChem CID | 24765357 |
| Molecular Formula | C20H22F3IN4O2S |
| Molecular Weight | 566.39 g/mol |
| Exact Mass | 566.05 |
| IUPAC Name | 2-N-[(1-but-3-enylcyclopropyl)sulfamoyl]-4,5-difluoro-3-N-(2-fluoro-4-iodophenyl)-1-N-methylbenzene-1,2,3-triamine |
| SMILES | C=CCCC1(NS(=O)(=O)Nc2c(NC)cc(F)c(F)c2Nc2ccc(I)cc2F)CC1 |
| InChI | InChI=1S/C20H22F3IN4O2S/c1-3-4-7-20(8-9-20)28-31(29,30)27-18-16(25-2)11-14(22)17(23)19(18)26-15-6-5-12(24)10-13(15)21/h3,5-6,10-11,25-28H,1,4,7-9H2,2H3 |
| InChIKey | PVMUJDZCTIPFBN-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.39 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|