C16H18F3IN4O2S — CID 11591614
1,2-difluoro-3-(2-fluoro-4-iodoanilino)-4-[[methyl-[2-(methylamino)ethyl]sulfamoyl]amino]benzene (PubChem CID 11591614) has the molecular formula C16H18F3IN4O2S and a molecular weight of 514.31 g/mol. Its IUPAC name is 1,2-difluoro-3-(2-fluoro-4-iodoanilino)-4-[[methyl-[2-(methylamino)ethyl]sulfamoyl]amino]benzene.
| Compound Name | 1,2-difluoro-3-(2-fluoro-4-iodoanilino)-4-[[methyl-[2-(methylamino)ethyl]sulfamoyl]amino]benzene |
|---|---|
| PubChem CID | 11591614 |
| Molecular Formula | C16H18F3IN4O2S |
| Molecular Weight | 514.31 g/mol |
| Exact Mass | 514.01 |
| IUPAC Name | 1,2-difluoro-3-(2-fluoro-4-iodoanilino)-4-[[methyl-[2-(methylamino)ethyl]sulfamoyl]amino]benzene |
| SMILES | CNCCN(C)S(=O)(=O)Nc1ccc(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C16H18F3IN4O2S/c1-21-7-8-24(2)27(25,26)23-14-6-4-11(17)15(19)16(14)22-13-5-3-10(20)9-12(13)18/h3-6,9,21-23H,7-8H2,1-2H3 |
| InChIKey | XADSYQGHWIWOEU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|