C16H10F3IN2O2S2 — CID 53492223
N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]thiophene-3-sulfonamide (PubChem CID 53492223) has the molecular formula C16H10F3IN2O2S2 and a molecular weight of 510.30 g/mol. Its IUPAC name is N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]thiophene-3-sulfonamide.
| Compound Name | N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 53492223 |
| Molecular Formula | C16H10F3IN2O2S2 |
| Molecular Weight | 510.30 g/mol |
| Exact Mass | 509.92 |
| IUPAC Name | N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]thiophene-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)c(F)c1Nc1ccc(I)cc1F)c1ccsc1 |
| InChI | InChI=1S/C16H10F3IN2O2S2/c17-11-2-4-14(22-26(23,24)10-5-6-25-8-10)16(15(11)19)21-13-3-1-9(20)7-12(13)18/h1-8,21-22H |
| InChIKey | VQLUFKCIQCLFPG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.30 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|