C21H14Cl2F3IN2O2S — CID 70828478
2-(2,4-dichlorophenyl)-N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]cyclopropane-1-sulfonamide (PubChem CID 70828478) has the molecular formula C21H14Cl2F3IN2O2S and a molecular weight of 613.23 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]cyclopropane-1-sulfonamide.
| Compound Name | 2-(2,4-dichlorophenyl)-N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]cyclopropane-1-sulfonamide |
|---|---|
| PubChem CID | 70828478 |
| Molecular Formula | C21H14Cl2F3IN2O2S |
| Molecular Weight | 613.23 g/mol |
| Exact Mass | 611.91 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]cyclopropane-1-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)c(F)c1Nc1ccc(I)cc1F)C1CC1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H14Cl2F3IN2O2S/c22-10-1-3-12(14(23)7-10)13-9-19(13)32(30,31)29-18-6-4-15(24)20(26)21(18)28-17-5-2-11(27)8-16(17)25/h1-8,13,19,28-29H,9H2 |
| InChIKey | SNNWMJZTKHAQLW-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.23 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|