C16H9BrF3IN2O2S2 — CID 53492429
4-bromo-N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]thiophene-3-sulfonamide (PubChem CID 53492429) has the molecular formula C16H9BrF3IN2O2S2 and a molecular weight of 589.20 g/mol. Its IUPAC name is 4-bromo-N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]thiophene-3-sulfonamide.
| Compound Name | 4-bromo-N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 53492429 |
| Molecular Formula | C16H9BrF3IN2O2S2 |
| Molecular Weight | 589.20 g/mol |
| Exact Mass | 587.83 |
| IUPAC Name | 4-bromo-N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]thiophene-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)c(F)c1Nc1ccc(I)cc1F)c1cscc1Br |
| InChI | InChI=1S/C16H9BrF3IN2O2S2/c17-9-6-26-7-14(9)27(24,25)23-13-4-2-10(18)15(20)16(13)22-12-3-1-8(21)5-11(12)19/h1-7,22-23H |
| InChIKey | LSYLSQQJNPBUMS-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.20 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|