C18H11F6IN2O3S — CID 59386354
N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-5-methyl-2-(trifluoromethyl)furan-3-sulfonamide (PubChem CID 59386354) has the molecular formula C18H11F6IN2O3S and a molecular weight of 576.26 g/mol. Its IUPAC name is N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-5-methyl-2-(trifluoromethyl)furan-3-sulfonamide.
| Compound Name | N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-5-methyl-2-(trifluoromethyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 59386354 |
| Molecular Formula | C18H11F6IN2O3S |
| Molecular Weight | 576.26 g/mol |
| Exact Mass | 575.94 |
| IUPAC Name | N-[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-5-methyl-2-(trifluoromethyl)furan-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccc(F)c(F)c2Nc2ccc(I)cc2F)c(C(F)(F)F)o1 |
| InChI | InChI=1S/C18H11F6IN2O3S/c1-8-6-14(17(30-8)18(22,23)24)31(28,29)27-13-5-3-10(19)15(21)16(13)26-12-4-2-9(25)7-11(12)20/h2-7,26-27H,1H3 |
| InChIKey | YPGZCOXPIVLCNP-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.26 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|